ch3cooch=ch2 + naoh

Phản ứng Vinyl axetat + NaOH hoặc CH3COOCH=CH2 + NaOH hoặc CH3COOCH=CH2 đi ra CH3COONa hoặc CH3COOCH=CH2 đi ra CH3CHO nằm trong loại phản xạ thủy phân este, phản xạ xà chống hóa đã và đang được cân đối đúng chuẩn và cụ thể nhất. Bên cạnh này đó là một trong những bài bác tập dượt với tương quan về CH3COOC2H3 với tiếng giải, mời mọc chúng ta đón xem:

CH3COOCH=CH2 + NaOH CH<sub>3</sub>COOC<sub>4</sub>H<sub>9</sub>  + NaOH   CH<sub>3</sub>COONa +  C<sub>4</sub>H<sub>9</sub>OH | CH3COOCH=CH2 đi ra CH3COONa | CH3COOCH=CH2 đi ra CH3CHO CH3COONa + CH3CHO

Quảng cáo

Bạn đang xem: ch3cooch=ch2 + naoh

1. Phương trình phản xạ CH3COOCH = CH2 ứng dụng với NaOH

CH3COOCH = CH2 + NaOH H2O,t° CH3COONa + CH3CHO

Phản ứng này nằm trong loại phản xạ xà chống hoá.

2. Hiện tượng của phản xạ CH3COOCH = CH2 ứng dụng với NaOH

- Sản phẩm sinh đi ra tạo ra kết tủa Ag Lúc mang lại phản xạ với AgNO3/NH3.

3. Cách tổ chức phản xạ CH3COOCH = CH2 ứng dụng với NaOH

- Cho 2ml etyl axetat vô ống thử, tiếp sau đó mang lại tiếp hỗn hợp 1 ml NaOH 30%. Lắc đều ống thử rồi đun cơ hội thủy vô 5 phút.

4. Mở rộng lớn về đặc thù hoá học tập của este

- Este bị thủy phân cả vô môi trường thiên nhiên axit và vô môi trường thiên nhiên kiềm.

+ Phản ứng thủy phân este vô môi trường thiên nhiên axit thông thường là phản xạ thuận nghịch:

Tổng quát:

RCOOR’ + H2O H2SO4,  to RCOOH + R’OH

Ví dụ:

CH3COOC2H5 + H2O H2SO4,  to CH3COOH + C­2H5OH

- Phản ứng thủy phân este vô môi trường thiên nhiên kiềm là phản ứng một chiều và còn được gọi là phản ứng xà chống hóa :

Tổng quát:

RCOOR’ + NaOH   toRCOONa + R’OH

Quảng cáo

Ví dụ:

CH3COOC2H5 + NaOH   to CH3COONa + C2H5OH

* Một số phản xạ thuỷ phân quan trọng đặc biệt của este

- Căn cứ vô sản phẩm của phản xạ thủy phân este tớ hoàn toàn có thể suy luận cấu tạo ra của este lúc đầu.

- Dưới đó là một trong những tình huống thuỷ phân quan trọng đặc biệt của este (không chứa chấp halogen) thông thường bắt gặp vô câu hỏi ấn định lượng là:

 Este đơn chức X + NaOH   to 2 muối hạt + H2O

X là este của phenol, với công thức là RCOOC6H5

Ví dụ:

CH3COOC6H5 + 2NaOH  toC6H5ONa + CH3COONa + H2O

 Este X + NaOH  to1 muối hạt + 1 anđehit

  X là este đơn chức, với công thức là RCOOCH=CHR’

Ví dụ:

CH3COOCH=CH2 + NaOH   toCH3COONa + CH3CHO

Este X + NaOH  to1 muối hạt + 1 xeton

X là este đơn chức, với công thức là R’–COO–C(R)=C(R”)R’’’

Ví dụ:

Quảng cáo

CH3–COO–C(CH3)=CH2 + NaOH   to CH3COONa + CH3 -CO-CH3

Ngoài đi ra, este còn tồn tại phản xạ ở gốc hiđrocacbon.

5. Bài tập dượt áp dụng liên quan

Câu 1: Thủy phân tristearin (C17H35COO)3C3H5) vô hỗn hợp NaOH, chiếm được muối hạt với công thức là

A. C2H3COONa. 

B. HCOONa. 

C. C17H33COONa. 

D. C17H35COONa.

Hướng dẫn giải:

Đáp án D

(C17H35COO)3C3H5 + 3 NaOH  to 3C17H35COONa + C3H5(OH)3

Câu 2: Khi thủy phân không còn 3,28 gam láo lếu hợp ý X bao gồm nhì este đơn chức, mạch hở thì nên vừa vặn đầy đủ 0,05 mol NaOH, chiếm được một muối hạt và láo lếu hợp ý Y bao gồm nhì ancol nằm trong mặt hàng đồng đẳng. Đốt cháy không còn Y vô O2 dư, chiếm được CO2 và m gam H2O. Giá trị của m là

A. 2,16. 

B. 3,06. 

C. 1,26. 

D. 1,71.

Hướng dẫn giải:

Đáp án A

Quảng cáo

nX = nNaOH = 0,05 mol → M¯X=3,280,05=65,6

→ Trong X chứa chấp este HCOOCH3 (M = 60)

Sản phẩm chỉ có một muối hạt là HCOONa (0,05).

Bảo toàn khối lượng:

mX+mNaOH=mHCOONa+mancolmancol=3,28+0,05.400,05.68=1,88gam

Quy thay đổi ancol trở thành CH3OH (0,05 mol) và CH2 (0,02 mol)

Bảo toàn yếu tắc H:

nH2O=0,05.2+0,02=0,12molmH2O=0,12.18=2,16gam

Câu 3: Khi thủy phân phenyl axetat vô hỗn hợp NaOH dư, đun rét mướt chiếm được thành phầm cơ học là

A. C6H5COONa và CH3OH. 

B. CH3COOH và C6H5ONa.

C. CH3COONa và C6H5ONa. 

D. CH3COONa và C6H5OH.

Hướng dẫn giải:

Đáp án C

CH3COOC6H5 + 2NaOH to CH3COONa + C6H5ONa+ H2O

Câu 4: Este X với công thức phân tử C4H8O2. Thủy phân X vô hỗn hợp H2SO4 loãng, đun rét mướt, chiếm được thành phầm bao gồm axit propionic và hóa học cơ học Y. Công thức của Y là

A. CH3OH.                     

B. C2H5OH.                    

C. CH3COOH.                

D. HCOOH.

Hướng dẫn giải:

Đáp án A

Este với 4C tuy nhiên thủy phân mang lại axit với 3C → hóa học cơ học Y là ancol metylic ( CH3OH)

Câu 5: Este X được tạo ra vày ancol metylic và axit axetic. Công thức của X là

A. HCOOC2H5.             

B. CH3COOC2H5.         

C. CH3COOCH3.          

Xem thêm: vở bài tập khoa học lớp 4

D. HCOOCH3.

Hướng dẫn giải:

Đáp án C

CH3COOH + CH3OH to,H2SO4 CH3COOCH3 + H2O

Câu 6: Hỗn hợp ý X bao gồm axit panmitic, axit stearic và triglixerit Y. Đốt cháy trọn vẹn m gam X, thu được một,56 mol CO2 và 1,52 mol H2O. Mặt không giống, m gam X ứng dụng vừa vặn đầy đủ với 0,09 mol NaOH vô hỗn hợp, chiếm được glixerol và hỗn hợp chỉ chứa chấp a gam láo lếu hợp ý muối hạt natri panmitat, natri stearat. Giá trị của a là

A. 26,40

B. 27,70

C. 25,86

D. 27,30

Hướng dẫn giải:

Đáp án C

Gọi số mol của những axit bự no và hóa học bự là x và nó (mol)

Khi mang lại X ứng dụng với NaOH: x + 3y = 0,09 (1)

Khi nhóm cháy X:

nCO2nH2O=2yy=0,02mol

→ x = 0,03 mol

Bảo toàn yếu tắc O:

nO(X)+2nO2=2nCO2+nH2O(2x+6y)+2nO2=2.1,56+1,52nO2=2,23mol

Bảo toàn lượng tớ có:

m=mCO2+mH2OmO2=24,64

Xét X ứng dụng với NaOH

nH2O=x=0,03molnglixerol=y=0,02mol

Bảo toàn khối lượng:

a=m+mNaOHmglixerolmH2Oa=25,86gam

Câu 7: Đun rét mướt este HCOOCH3 với cùng một lượng vừa vặn đầy đủ hỗn hợp NaOH, thành phầm chiếm được là

A. CH3COONa và C2H5OH.              

B. HCOONa và CH3OH.

C. HCOONa và C2H5OH.                 

D. CH3COONa và CH3OH.

Hướng dẫn giải:

Đáp án B

HCOOCH3 + NaOH to HCOONa + CH3OH

Câu 8: Este đơn chức X với tỉ khối khá đối với CH4 là 6,25. Cho đôi mươi gam X ứng dụng với 300 ml hỗn hợp KOH 1M (đun nóng). Cô cạn hỗn hợp sau phản xạ chiếm được 28 gam hóa học rắn khan. Công thức của X là

A. HCOOC4H7.             

B. CH3COOC3H5

C. C2H3COOC2H5.

D. C2H5COOC2H3.

Hướng dẫn giải:

Đáp án D

MX = 16.6,25 = 100 → X ko cần este của phenol

→ Công thức của X với dạng RCOOR’

nX = 0,2 mol; nKOH = 0,3 mol

Phương trình:

RCOOR’ + KOH to RCOOK + R’OH

Chất rắn khan bao gồm RCOOK (0,2mol) và KOH dư (0,1mol)

→ 0,2. (R+83) + 0,1.56 = 28

→ R= 29 (C2H5-)

→ R’= 100-29-44= 27 (CH2=CH-­)

Vậy công thức của este là C2H5COOC2H3.

Câu 9: Este X ko no, mạch hở, với tỉ khối khá đối với oxi vày 3,125. Cho X ứng dụng trọn vẹn với NaOH chiếm được một anđehit và một muối hạt của axit cơ học. Số công thức kết cấu phù phù hợp với X là

A. 2.           

B. 3.           

C. 4.           

D.5.

Hướng dẫn giải:

Đáp án C

Ta có: MX = 32.3,125 =100 (C5H8O2)

Cho X ứng dụng trọn vẹn với NaOH chiếm được một anđehit và một muối hạt của axit cơ học → X là este ko no, đơn chức tạo ra vày axit đơn chức và ankin.

Vậy X hoàn toàn có thể là:

HCOOCH=CH-CH2-CH3

HCOOCH=C(CH3)-CH3

CH3COOCH=CH-CH3

C2H5COOCH=CH2

Có 4 công thức kết cấu thỏa mãn 

Câu 10: Cho một axit no, đơn chức, mạch hở X ứng dụng trọn vẹn với hỗn hợp NaOH. Cô cạn hỗn hợp chiếm được láo lếu hợp ý rắn Y. Nung Y vô không gian chiếm được 15,9 gam Na2CO3, 2,24 lít CO2 (đktc) và 6,3 gam H2O. Công thức của X là

A. CH3COOH.     

B. C2H5COOH.    

C. C3H7COOH.    

D. C4H9COOH.

Hướng dẫn giải:

Đáp án D

nNa2CO3=0,15mol; nCO2=0,1molnH2O=0,35mol

Gọi công thức của muối hạt là CnH2n-1O2Na

Bảo toàn yếu tắc C: nC = 0,15 + 0,1 = 0,25 mol

→ nmuối = 0,25/n mol

→ nNaOH dư = 0,3-0,25/n (mol)

Bảo toàn yếu tắc H tớ có:

nH (muối) + nH (NaOH dư) = 2 nnước

(2n1)0,25n+(0,30,25n)=2.0,35n=5

→ Công thức của axit là C4H9COOH.

Xem thêm: tơ nitron thuộc loại tơ

Xem tăng những phương trình chất hóa học hoặc khác:

  • HCOOC2H5 + HOH ⇋ HCOOH + C2H5OH
  • HCOOC2H5 + NaOH → HCOONa + C2H5OH
  • 2HCOOC2H5 + 7O2 → 6CO2 + 6H2O
  • HCOOC2H5 + 2AgNO3 + 3NH3 + H2O → 2Ag + 2NH4NO3 + NH4OCOOC2H5
  • CH3COOCH=CH2 + HOH ⇋ CH3COOH + CH3CHO
  • 2CH3COOC2H3 + 9O2 → 8CO2 + 6H2O
  • CH3COOCH=CH2 + H2 → CH3COOCH2CH3
  • Phản ứng trùng khớp Vinyl axetat

Săn SALE shopee mon 11:

  • Đồ sử dụng học hành giá rất rẻ
  • Sữa chăm sóc thể Vaseline chỉ rộng lớn 40k/chai
  • Tsubaki 199k/3 chai
  • L'Oreal mua 1 tặng 3

ĐỀ THI, GIÁO ÁN, GÓI THI ONLINE DÀNH CHO GIÁO VIÊN VÀ PHỤ HUYNH LỚP 12

Bộ giáo án, đề thi đua, bài bác giảng powerpoint, khóa đào tạo và huấn luyện giành cho những thầy cô và học viên lớp 12, đẩy đầy đủ những cuốn sách cánh diều, liên kết trí thức, chân mây phát minh bên trên https://tailieugiaovien.com.vn/ . Hỗ trợ zalo VietJack Official

phuong-trinh-hoa-hoc-cua-este.jsp